219945-56-9 Usage
Uses
Used in Organic Synthesis:
4-(Isopropylamino)phenylboronic acid is used as a reagent in the Suzuki-Miyaura coupling reaction for the formation of carbon-carbon bonds. This reaction is widely employed in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(Isopropylamino)phenylboronic acid is utilized for the synthesis of novel drug candidates. Its unique structure and reactivity make it a valuable component in the development of new therapeutic agents with potential applications in treating various diseases and conditions.
Used in Material Science:
4-(Isopropylamino)phenylboronic acid is also employed in the development of new materials. Its properties and reactivity contribute to the creation of innovative materials with unique characteristics and potential applications in various fields, such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 219945-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,9,4 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 219945-56:
(8*2)+(7*1)+(6*9)+(5*9)+(4*4)+(3*5)+(2*5)+(1*6)=169
169 % 10 = 9
So 219945-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H14BNO2/c1-7(2)11-9-5-3-8(4-6-9)10(12)13/h3-7,11-13H,1-2H3
