219998-30-8 Usage
General Description
Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) is a specific structure of the Benzene chemical compound, characterized by the presence of three Fluorine atoms and one Methoxy group attached to the benzene ring. Given the (9CI) designation, this indicates that it has been cataloged in the ninth collective index, a system of classification used by the Chemical Abstract Service. The inclusion of Fluorine atoms significantly alters the properties of the basic benzene molecule, making it more reactive. This chemical is typically used in various research contexts, particularly where reactivity with other compounds is required. As with most chemical compounds, safety precautions must be taken when handling this substance due to its reactivity and potential health effects.
Check Digit Verification of cas no
The CAS Registry Mumber 219998-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,9,9 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 219998-30:
(8*2)+(7*1)+(6*9)+(5*9)+(4*9)+(3*8)+(2*3)+(1*0)=188
188 % 10 = 8
So 219998-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3