219998-30-8 Usage
Uses
Used in Chemical Research:
Benzene, 1,3,5-trifluoro-2-methoxy(9CI) is used as a research compound for its unique reactivity with other compounds. The presence of Fluorine atoms makes it a valuable tool in various chemical reactions and synthesis processes, contributing to the development of new materials and compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Benzene, 1,3,5-trifluoro-2-methoxy(9CI) is used as an intermediate or building block in the synthesis of various drug molecules. Its reactivity allows for the creation of new compounds with potential therapeutic applications, enhancing the range of available treatments for various medical conditions.
Used in Material Science:
Benzene, 1,3,5-trifluoro-2-methoxy(9CI) is used as a component in the development of new materials with specific properties. Its reactivity and the ability to form stable bonds with other elements make it a key player in the creation of advanced materials for various applications, such as electronics, coatings, and adhesives.
Safety Precautions:
As with most chemical compounds, safety precautions must be taken when handling Benzene, 1,3,5-trifluoro-2-methoxy(9CI) due to its reactivity and potential health effects. Proper handling, storage, and disposal protocols should be followed to minimize risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 219998-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,9,9 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 219998-30:
(8*2)+(7*1)+(6*9)+(5*9)+(4*9)+(3*8)+(2*3)+(1*0)=188
188 % 10 = 8
So 219998-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3