220137-70-2 Usage
Explanation
Different sources of media describe the Explanation of 220137-70-2 differently. You can refer to the following data:
1. 1-PIPERIDIN-1-YLMETHYL-CYCLOHEXYLAMINE is a chemical compound composed of 13 carbon atoms, 25 hydrogen atoms, and 1 nitrogen atom.
2. Derivative of piperidine and cyclohexylamine
2. This compound is derived from two main structures, a piperidine ring, and a cyclohexylamine group, which are combined to form the 1-PIPERIDIN-1-YLMETHYL-CYCLOHEXYLAMINE structure.
3. Piperidine ring with cyclohexylamine group
3. The structure of 1-PIPERIDIN-1-YLMETHYL-CYCLOHEXYLAMINE consists of a five-membered nitrogen-containing piperidine ring with a cyclohexylamine group attached to the nitrogen atom.
4. Industrial and pharmaceutical applications
4. This compound is used in various industries, such as pharmaceuticals and agrochemicals, as a building block in the synthesis of different fine chemicals.
5. Use as a reagent and intermediate
5. 1-PIPERIDIN-1-YLMETHYL-CYCLOHEXYLAMINE can be used as a reagent in organic synthesis, helping to drive chemical reactions forward, and as an intermediate in the production of other chemical compounds, contributing to their formation.
6. Potential hazards and handling precautions
6. Exposure to high concentrations of 1-PIPERIDIN-1-YLMETHYL-CYCLOHEXYLAMINE can be harmful. It may cause irritation to the eyes, skin, and respiratory system. It is important to handle this compound with care and follow proper safety precautions.
Check Digit Verification of cas no
The CAS Registry Mumber 220137-70-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,1,3 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 220137-70:
(8*2)+(7*2)+(6*0)+(5*1)+(4*3)+(3*7)+(2*7)+(1*0)=82
82 % 10 = 2
So 220137-70-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H24N2/c13-12(7-3-1-4-8-12)11-14-9-5-2-6-10-14/h1-11,13H2
