220210-55-9 Usage
Uses
Used in Organic Synthesis:
2,4,5-Trichlorophenylboronic acid is used as a reagent for coupling reactions in organic synthesis, facilitating the formation of carbon-carbon and carbon-heteroatom bonds. Its unique structure and reactivity make it a valuable component in creating complex organic molecules.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2,4,5-Trichlorophenylboronic acid is utilized as a building block for the synthesis of various drugs. Its ability to form stable boronate esters aids in the development of new medicinal compounds with potential therapeutic applications.
Used in Agrochemical Synthesis:
2,4,5-Trichlorophenylboronic acid also finds application in the agrochemical sector, where it serves as a key component in the synthesis of pesticides and other agricultural chemicals. Its versatility in forming different types of chemical bonds contributes to the creation of effective and targeted agrochemicals.
Used in Materials Science:
In the field of materials science, 2,4,5-Trichlorophenylboronic acid is employed in the synthesis of advanced materials with specific properties. Its role in forming stable boronate esters allows for the development of materials with tailored characteristics for various applications, such as electronics, coatings, and composites.
Check Digit Verification of cas no
The CAS Registry Mumber 220210-55-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,2,1 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 220210-55:
(8*2)+(7*2)+(6*0)+(5*2)+(4*1)+(3*0)+(2*5)+(1*5)=59
59 % 10 = 9
So 220210-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BCl3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,11-12H
