220227-74-7 Usage
Uses
Used in Pharmaceutical Industry:
3',4',5'-Trifluoropropiophenone is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to enhance the properties of drugs, such as increasing their stability and bioavailability.
Used in Agrochemical Industry:
In the agrochemical sector, 3',4',5'-Trifluoropropiophenone is employed as a precursor in the production of agrochemicals, contributing to the development of more effective and targeted pesticides and other agricultural chemicals.
Used in Organic Synthesis:
3',4',5'-Trifluoropropiophenone is used as a versatile building block in organic synthesis, particularly for the creation of fluorinated compounds, which often exhibit improved chemical and biological properties compared to their non-fluorinated counterparts.
Used in Research and Development:
As a research chemical, 3',4',5'-Trifluoropropiophenone is utilized in the development of new materials with unique properties, such as enhanced reactivity, stability, or selectivity in chemical reactions, thereby contributing to advancements in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 220227-74-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,2,2 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 220227-74:
(8*2)+(7*2)+(6*0)+(5*2)+(4*2)+(3*7)+(2*7)+(1*4)=87
87 % 10 = 7
So 220227-74-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H7F3O/c1-2-8(13)5-3-6(10)9(12)7(11)4-5/h3-4H,2H2,1H3
