220228-03-5 Usage
Uses
Used in Pharmaceutical Industry:
3,4,5-Trifluorophenylacetonitrile is used as an intermediate or building block in the synthesis of pharmaceuticals for its ability to contribute to the development of fluorinated organic compounds. These compounds are often desired for their enhanced properties, such as increased metabolic stability and bioavailability, which can lead to improved drug efficacy and safety.
Used in Agrochemical Industry:
In the agrochemical sector, 3,4,5-Trifluorophenylacetonitrile serves as a key intermediate in the production of agrochemicals. Its trifluorophenyl group is utilized to create compounds with specific pesticidal or herbicidal properties, potentially leading to more effective and targeted crop protection solutions.
Safety Precautions:
Due to its potentially hazardous properties, 3,4,5-Trifluorophenylacetonitrile must be handled and stored with appropriate safety measures. This includes following proper guidelines to minimize risks associated with its use in chemical reactions and synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 220228-03-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,2,2 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 220228-03:
(8*2)+(7*2)+(6*0)+(5*2)+(4*2)+(3*8)+(2*0)+(1*3)=75
75 % 10 = 5
So 220228-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H4F3N/c9-6-3-5(1-2-12)4-7(10)8(6)11/h3-4H,1H2
220228-03-5Relevant academic research and scientific papers
SUBSTITUTED PHENYL ETHER COMPOUND AND PEST CONTROL AGENT
-
Paragraph 0241, (2016/10/08)
PROBLEM TO BE SOLVED: To provide a novel substituted phenyl ether compound having pest controlling effect and a pest control agent comprising the compound as an active ingredient. SOLUTION: The present invention provides a substituted phenyl ether compound represented by the formula (1-2). COPYRIGHT: (C)2015,JPOandINPIT
