220247-71-2 Usage
Uses
Used in Pharmaceutical Industry:
1,2,3,4-Tetrahydroisoquinoline-7-carboxylic acid hydrochloride is used as a pharmaceutical compound for its potential therapeutic applications, including the treatment of neurological disorders. Its hydrochloride salt form improves solubility and stability, making it suitable for pharmaceutical formulations.
Used in Organic Chemistry:
1,2,3,4-Tetrahydroisoquinoline-7-carboxylic acid hydrochloride is used as a precursor in organic chemistry for the synthesis of various molecules. Its unique structure and properties make it a valuable building block for creating new organic compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 220247-71-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,2,4 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 220247-71:
(8*2)+(7*2)+(6*0)+(5*2)+(4*4)+(3*7)+(2*7)+(1*1)=92
92 % 10 = 2
So 220247-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.ClH/c12-10(13)8-2-1-7-3-4-11-6-9(7)5-8;/h1-2,5,11H,3-4,6H2,(H,12,13);1H
