220616-39-7 Usage
General Description
3-Cyanomethylphenylboronic acid is a chemical compound with the formula C8H8BNO2. It is used as a reagent in organic synthesis, particularly in the formation of carbon-carbon or carbon-heteroatom bonds. 3-CYANOMETHYLPHENYLBORONIC ACID possesses a boronic acid group and a cyano group, which makes it a versatile and useful building block in the production of pharmaceuticals and agrochemicals. Additionally, 3-Cyanomethylphenylboronic acid has been studied for its potential application in the development of fluorescent sensors and organic electronic materials due to its unique electronic properties. As a result, this chemical plays a crucial role in the advancement of various fields, including medicinal chemistry, materials science, and chemical biology.
Check Digit Verification of cas no
The CAS Registry Mumber 220616-39-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,6,1 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 220616-39:
(8*2)+(7*2)+(6*0)+(5*6)+(4*1)+(3*6)+(2*3)+(1*9)=97
97 % 10 = 7
So 220616-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BNO2/c10-5-4-7-2-1-3-8(6-7)9(11)12/h1-3,6,11-12H,4H2
