221010-68-0 Usage
Uses
Used in Organic Synthesis:
9,9-DIMETHYL-9H-FLUORENE-2,7-DIOL is used as a key intermediate in organic synthesis for the preparation of various complex organic molecules. Its unique structure and reactivity allow for the formation of diverse chemical entities, making it a versatile building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 9,9-DIMETHYL-9H-FLUORENE-2,7-DIOL is used as a building block for the development of drug molecules. Its presence in the molecular structure can impart specific biological activities, such as anti-inflammatory, analgesic, or antipyretic properties. 9,9-DIMETHYL-9H-FLUORENE-2,7-DIOL's ability to form hydrogen bonds due to its hydroxyl groups can also enhance the drug's solubility and bioavailability, leading to improved therapeutic efficacy.
Used in Chemical Research and Development:
9,9-DIMETHYL-9H-FLUORENE-2,7-DIOL is utilized in the field of chemical research and development for the exploration of new reaction pathways and the synthesis of novel compounds. Its unique structure and reactivity make it an attractive candidate for studying the mechanisms of various organic reactions, as well as for the development of new catalysts and reagents that can improve the efficiency and selectivity of chemical processes.
Used in Drug Discovery:
In drug discovery, 9,9-DIMETHYL-9H-FLUORENE-2,7-DIOL is employed as a potential lead compound for the development of new therapeutic agents. Its structural features and reactivity can be exploited to design and optimize drug candidates with specific pharmacological properties, such as selectivity for particular biological targets or improved pharmacokinetic profiles. 9,9-DIMETHYL-9H-FLUORENE-2,7-DIOL's potential applications in drug discovery can contribute to the advancement of novel treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 221010-68-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,0,1 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 221010-68:
(8*2)+(7*2)+(6*1)+(5*0)+(4*1)+(3*0)+(2*6)+(1*8)=60
60 % 10 = 0
So 221010-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O2/c1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h3-8,16-17H,1-2H3
221010-68-0Relevant academic research and scientific papers
Wu, Jie,Liu, Wei,Liang, Li,Gan, Ya,Xia, Shuang,Gou, Xiaojun,Sun, Xiaohua
, (2020)
The Pechmann condensation of phenolic fluorenes with ethyl acetoacetate afforded indene-fused 4-methylcoumarins. In addition to the expected indeno[1,2-g]coumarin, a skeletal rearranged compound was obtained as a concomitant product when 9,9-dimethyl-9H-fluorene-2,7-diol was utilized as the substrate. X-ray crystallography was used to identify the structures of the isomers. Photochemical and photophysical studies indicated that compared with the non-rearranged products, the skeletal rearranged isomers have red shifted absorption maxima and much higher fluorescence quantum yields. A mechanism involving two competitive pathways for the simultaneous production of isomers was proposed.