221050-96-0 Usage
Uses
Used in Pharmaceutical Industry:
7-Isoquinolinecarboxylic acid is used as a pharmaceutical precursor for its potential anti-inflammatory and anticancer activities. It is recognized for its ability to modulate various biological pathways and processes, making it a candidate for the development of new therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 7-isoquinolinecarboxylic acid is utilized as a key building block. Its unique structure allows for the creation of a wide range of chemical compounds, contributing to the advancement of chemical research and the development of novel substances with diverse applications.
Used in the Synthesis of Bioactive Compounds:
7-Isoquinolinecarboxylic acid is employed as a precursor in the synthesis of various bioactive compounds. Its role in this process is crucial for the production of molecules with significant biological activity, which can be further explored for their potential applications in medicine and other related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 221050-96-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,0,5 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 221050-96:
(8*2)+(7*2)+(6*1)+(5*0)+(4*5)+(3*0)+(2*9)+(1*6)=80
80 % 10 = 0
So 221050-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO2/c12-10(13)8-2-1-7-3-4-11-6-9(7)5-8/h1-6H,(H,12,13)
