221202-34-2 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Difluoro-6-methoxybenzonitrile is used as a building block for the synthesis of various drugs, contributing to the development of new medicinal compounds due to its unique structural features.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3-difluoro-6-methoxybenzonitrile serves as a key intermediate in the production of pesticides and other crop protection agents, enhancing agricultural productivity and crop protection.
Used in Organic Synthesis:
2,3-Difluoro-6-methoxybenzonitrile is utilized as an intermediate in the synthesis of other organic compounds, playing a crucial role in the creation of a wide range of chemical products for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 221202-34-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,2,0 and 2 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 221202-34:
(8*2)+(7*2)+(6*1)+(5*2)+(4*0)+(3*2)+(2*3)+(1*4)=62
62 % 10 = 2
So 221202-34-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F2NO/c1-12-7-3-2-6(9)8(10)5(7)4-11/h2-3H,1H3
