22133-95-5 Usage
Uses
Used in Pesticide and Herbicide Production:
2,3,5,6-Tetrachlorophenyl isothiocyanate is used as a key intermediate in the synthesis of pesticides and herbicides. Its chemical properties allow for the development of effective compounds that control, repel, or kill unwanted plants and insects, contributing to agricultural productivity and crop protection.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, 2,3,5,6-tetrachlorophenyl isothiocyanate serves as an intermediate for the production of various medicinal compounds. Its unique structure enables the creation of drugs with specific therapeutic properties, addressing a range of health conditions and medical needs.
Used in Chemical Product Synthesis:
Beyond its applications in agriculture and medicine, 2,3,5,6-tetrachlorophenyl isothiocyanate is also utilized in the synthesis of other chemical products. Its versatility as a chemical intermediate makes it valuable in the development of a diverse array of industrial and consumer goods, from dyes to plastics.
Given the hazardous nature of 2,3,5,6-tetrachlorophenyl isothiocyanate, it is crucial to implement stringent safety measures during its production, handling, and use to minimize exposure risks and ensure the well-being of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 22133-95-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,1,3 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22133-95:
(7*2)+(6*2)+(5*1)+(4*3)+(3*3)+(2*9)+(1*5)=75
75 % 10 = 5
So 22133-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C7HCl4NS/c8-3-1-4(9)6(11)7(5(3)10)12-2-13/h1H
