22137-52-6 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Amino-3,5-dichlor0-6-methylpyridine is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of diverse drug candidates with potential therapeutic applications, making it an essential component in medicinal chemistry.
Used in Agrochemical Development:
In the agrochemical industry, 2-Amino-3,5-dichlor0-6-methylpyridine serves as a crucial building block for the development of new pesticides and other agrochemicals. Its incorporation into these compounds can enhance their effectiveness in protecting crops and controlling pests, thereby contributing to increased agricultural productivity.
Used in Research and Industrial Applications:
2-Amino-3,5-dichlor0-6-methylpyridine is also employed in research settings for the exploration of its chemical properties and potential applications. Its use in industrial applications is driven by its versatility as a synthetic intermediate, facilitating the production of a wide range of chemical products and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 22137-52-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,1,3 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 22137-52:
(7*2)+(6*2)+(5*1)+(4*3)+(3*7)+(2*5)+(1*2)=76
76 % 10 = 6
So 22137-52-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6Cl2N2/c1-3-4(7)2-5(8)6(9)10-3/h2H,1H3,(H2,9,10)
