221640-06-8 Usage
Uses
Used in Pharmaceutical Research:
(S)-N1-(2-aminoethyl)-3-(4-ethoxyphenyl)propane-1,2-diamine.3HCl is utilized as a research compound for exploring its potential in various therapeutic areas. Its unique structure and functional groups make it a candidate for the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Drug Development:
In the pharmaceutical industry, (S)-N1-(2-aminoethyl)-3-(4-ethoxyphenyl)propane-1,2-diamine.3HCl is used as a lead compound for drug development. Its chemical properties and interactions with biological systems are being investigated to identify possible applications in treating diseases or conditions that require novel therapeutic interventions.
Used in Chemical Synthesis:
(S)-N1-(2-aminoethyl)-3-(4-ethoxyphenyl)propane-1,2-diamine.3HCl may also serve as an intermediate in the synthesis of other complex organic compounds. Its versatile structure allows for further chemical modifications, making it a valuable building block in the creation of new molecules with specific functions or properties.
Check Digit Verification of cas no
The CAS Registry Mumber 221640-06-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,6,4 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 221640-06:
(8*2)+(7*2)+(6*1)+(5*6)+(4*4)+(3*0)+(2*0)+(1*6)=88
88 % 10 = 8
So 221640-06-8 is a valid CAS Registry Number.
InChI:InChI=1S/C13H23N3O.3ClH/c1-2-17-13-5-3-11(4-6-13)9-12(15)10-16-8-7-14;;;/h3-6,12,16H,2,7-10,14-15H2,1H3;3*1H/t12-;;;/m0.../s1
