22173-83-7 Usage
Uses
Used in Organic and Pharmaceutical Synthesis:
DMAPA chloride is used as a phase transfer catalyst for facilitating the transfer of hydrophobic molecules between immiscible liquid phases. Its steric hindrance and bulky structure make it an effective catalyst in reactions involving nucleophilic substitution, alkylation, and oxidation processes.
Used in Asymmetric Synthesis:
DMAPA chloride has shown potential as a reagent for asymmetric synthesis, a technique used to produce enantiomerically pure compounds. Its unique structure allows for selective reactions, leading to the formation of specific enantiomers.
Used in the Development of Pharmaceuticals and Agrochemicals:
DMAPA chloride is a valuable tool in the development of new pharmaceuticals, agrochemicals, and other fine chemicals. Its ability to act as a phase transfer catalyst in various chemical reactions enables the synthesis of complex molecules with potential therapeutic or pesticidal properties.
However, it is important to handle and store DMAPA chloride with caution, as it is a corrosive and toxic compound. Proper safety measures should be taken to minimize exposure and potential hazards during its use in chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 22173-83-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,1,7 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 22173-83:
(7*2)+(6*2)+(5*1)+(4*7)+(3*3)+(2*8)+(1*3)=87
87 % 10 = 7
So 22173-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H23N.ClH/c1-15(19(2)3)14-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17;/h4-13,15,18H,14H2,1-3H3;1H
