22181-94-8 Usage
Uses
Used in Biochemical Research:
Ethyl N-[1-oxo-5-(1H-purin-6-ylthio)pentyl]glycinate is used as a research compound for studying its interactions with biological systems and understanding its potential role in nucleic acid metabolism or purine-related signaling pathways.
Used in Pharmaceutical Development:
In the pharmaceutical industry, ethyl N-[1-oxo-5-(1H-purin-6-ylthio)pentyl]glycinate is used as a lead compound for the development of new drugs, given its unique structure and potential biological activity. Its exploration may contribute to the discovery of novel therapeutic agents targeting specific diseases or conditions related to purine metabolism or signaling.
Used in Chemical Synthesis:
Ethyl N-[1-oxo-5-(1H-purin-6-ylthio)pentyl]glycinate may also be utilized as an intermediate in the synthesis of other complex organic molecules, particularly those with potential applications in medicine or other specialized fields.
Check Digit Verification of cas no
The CAS Registry Mumber 22181-94-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,1,8 and 1 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22181-94:
(7*2)+(6*2)+(5*1)+(4*8)+(3*1)+(2*9)+(1*4)=88
88 % 10 = 8
So 22181-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H19N5O3S/c1-2-22-11(21)7-15-10(20)5-3-4-6-23-14-12-13(17-8-16-12)18-9-19-14/h8-9,12H,2-7H2,1H3,(H,15,20)
