22220-44-6 Usage
Uses
Used in Organic Synthesis:
2,5-Dihydroxy-3-methyl-6-nonyl-2,5-cyclohexadiene-1,4-dione is used as a key intermediate in organic synthesis for the production of various complex organic molecules. Its unique structure allows for multiple points of reactivity, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Reactions as a Reagent:
In the field of chemistry, 2,5-Dihydroxy-3-methyl-6-nonyl-2,5-cyclohexadiene-1,4-dione serves as a reagent in a variety of chemical reactions. Its presence can facilitate or enhance the reaction processes, leading to the formation of desired products with improved efficiency and selectivity.
Used in Pharmaceutical Industry:
2,5-Dihydroxy-3-methyl-6-nonyl-2,5-cyclohexadiene-1,4-dione is used as a building block in the development of new pharmaceutical compounds. Its structural features can be exploited to create novel drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
2,5-Dihydroxy-3-methyl-6-nonyl-2,5-cyclohexadiene-1,4-dione is also utilized in the agrochemical sector, where it can be employed in the synthesis of new pesticides, herbicides, or other crop protection agents. Its unique properties may contribute to the development of more effective and environmentally friendly agrochemicals.
Used in Materials Science:
2,5-Dihydroxy-3-methyl-6-nonyl-2,5-cyclohexadiene-1,4-dione has potential applications in materials science, where it could be used to develop new materials with specific properties. Its versatility and reactivity make it a candidate for creating advanced materials for various applications, such as coatings, adhesives, or polymers with tailored characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 22220-44-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,2 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22220-44:
(7*2)+(6*2)+(5*2)+(4*2)+(3*0)+(2*4)+(1*4)=56
56 % 10 = 6
So 22220-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H24O4/c1-3-4-5-6-7-8-9-10-12-15(19)13(17)11(2)14(18)16(12)20/h17,20H,3-10H2,1-2H3
