22264-16-0 Usage
Uses
Used in Pharmaceutical Industry:
1-Amino-cyclobutanecarboxylic acid is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential biological activities. Its unique cyclic structure allows for the development of new drug molecules with specific therapeutic properties.
Used in Organic Chemistry:
1-Amino-cyclobutanecarboxylic acid is used as a building block in organic chemistry for the synthesis of complex organic compounds. Its versatile structure enables the creation of a wide range of chemical entities with diverse applications.
Used in Research and Development:
1-Amino-cyclobutanecarboxylic acid is utilized in research settings to explore its potential applications and to study the biological activities of its derivatives. 1-Amino-cyclobutanecarboxylic acid serves as a valuable tool for scientists working in the fields of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 22264-16-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,6 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22264-16:
(7*2)+(6*2)+(5*2)+(4*6)+(3*4)+(2*1)+(1*6)=80
80 % 10 = 0
So 22264-16-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H12BrN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15)
