22264-16-0 Usage
General Description
1-Amino-cyclobutanecarboxylic acid, also known as 1-Aminocyclobutane-1-carboxylic acid, is a chemical compound with the molecular formula C5H9NO2. It is a cyclic amino acid, which contains a cyclobutane ring and an attached amino group. 1-Amino-cyclobutanecarboxylic acid is not naturally occurring but can be synthesized in the laboratory. It has potential applications in the fields of pharmaceuticals and organic chemistry, and its derivatives have been studied for their potential biological activities. 1-Amino-cyclobutanecarboxylic acid has also been investigated for its role in the development of new drug molecules and as a building block for the synthesis of complex organic compounds. Overall, this compound has the potential for various industrial and research applications due to its unique structural and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 22264-16-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,6 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22264-16:
(7*2)+(6*2)+(5*2)+(4*6)+(3*4)+(2*1)+(1*6)=80
80 % 10 = 0
So 22264-16-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H12BrN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15)
