22276-99-9 Usage
Uses
Used in Pharmaceutical Research:
4-Amino-5-bromopyrrolo[2,3-d]pyrimidine is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
As a heterocyclic compound, 4-Amino-5-bromopyrrolo[2,3-d]pyrimidine is used as a building block in the synthesis of complex organic molecules. Its versatility in chemical reactions enables the creation of a wide range of compounds with diverse properties.
Used in Materials Science:
4-Amino-5-bromopyrrolo[2,3-d]pyrimidine may have potential applications in the field of materials science, where its unique structure and properties can be utilized to develop new materials with specific characteristics.
Used in Supramolecular Chemistry:
In supramolecular chemistry, 4-Amino-5-bromopyrrolo[2,3-d]pyrimidine can be used to construct supramolecular assemblies and complexes, which can exhibit novel properties and functions not found in individual molecules.
Overall, 4-Amino-5-bromopyrrolo[2,3-d]pyrimidine is a promising compound with diverse applications in various fields, including pharmaceuticals, organic synthesis, materials science, and supramolecular chemistry. Its potential for further research and development makes it an exciting area of study for chemists and researchers.
Check Digit Verification of cas no
The CAS Registry Mumber 22276-99-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,7 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 22276-99:
(7*2)+(6*2)+(5*2)+(4*7)+(3*6)+(2*9)+(1*9)=109
109 % 10 = 9
So 22276-99-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrN4/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H3,8,9,10,11)
