222987-21-5 Usage
Uses
Used in Organic Synthesis:
4-(2-AMINOPYRIMIDIN-5-YL)BENZOIC ACID is used as a building block for the synthesis of various bioactive compounds due to its unique structure and properties.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 4-(2-AMINOPYRIMIDIN-5-YL)BENZOIC ACID is used as a key intermediate in the development of new drugs, contributing to the creation of molecules with potential therapeutic effects.
Used in Coordination Chemistry:
4-(2-AMINOPYRIMIDIN-5-YL)BENZOIC ACID is used as a ligand in coordination chemistry, playing a crucial role in the formation of metal complexes with specific properties and applications.
Used in Agrochemical Production:
In the agrochemical industry, 4-(2-AMINOPYRIMIDIN-5-YL)BENZOIC ACID is used as a starting material for the synthesis of various agrochemicals, including pesticides and herbicides, due to its reactivity and potential to form active compounds.
Used in Drug Development and Discovery:
4-(2-AMINOPYRIMIDIN-5-YL)BENZOIC ACID is used as a compound of interest in drug development and discovery, being studied for its potential pharmacological properties and its ability to contribute to the creation of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 222987-21-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,2,9,8 and 7 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 222987-21:
(8*2)+(7*2)+(6*2)+(5*9)+(4*8)+(3*7)+(2*2)+(1*1)=145
145 % 10 = 5
So 222987-21-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H9N3O2/c12-11-13-5-9(6-14-11)7-1-3-8(4-2-7)10(15)16/h1-6H,(H,15,16)(H2,12,13,14)
