223513-02-8 Usage
General Description
2-(4-Acetyl-piperazin-1-yl)-5-fluoroaniline is a chemical compound that has potential applications in the pharmaceutical industry. It is a derivative of piperazine, which is commonly used as a building block in the synthesis of various pharmaceutical drugs. The presence of the acetyl group and the fluorine atom in the compound's structure make it a valuable intermediate for the development of new drugs with improved biological activity and pharmacokinetic properties. 2-(4-Acetyl-piperazin-1-yl)-5-fluoroaniline can be used as a starting material for the synthesis of potential therapeutic agents, such as antipsychotics, antidepressants, and antiviral drugs. Its unique chemical structure makes it an important molecule in medicinal chemistry research and drug discovery efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 223513-02-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,5,1 and 3 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 223513-02:
(8*2)+(7*2)+(6*3)+(5*5)+(4*1)+(3*3)+(2*0)+(1*2)=88
88 % 10 = 8
So 223513-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H16FN3O/c1-9(17)15-4-6-16(7-5-15)12-3-2-10(13)8-11(12)14/h2-3,8H,4-7,14H2,1H3
