22358-80-1 Usage
Uses
Used in Organic Synthesis:
Thiazole-4,5-dicarboxylic acid is utilized as a key intermediate in organic synthesis for the preparation of a variety of chemical compounds. Its unique structure allows for the creation of complex molecules that are otherwise challenging to synthesize, making it a valuable component in the field of organic chemistry.
Used in Pharmaceutical Research:
In pharmaceutical research, thiazole-4,5-dicarboxylic acid is employed as a building block for the synthesis of pharmaceuticals. Its incorporation into drug molecules can enhance their therapeutic properties, such as improving their efficacy, selectivity, or bioavailability.
Used in Drug Development:
As a precursor for the preparation of thiazole-based drugs, thiazole-4,5-dicarboxylic acid plays a crucial role in drug development. Thiazole-containing compounds are known for their diverse range of biological activities, including antimicrobial, anti-inflammatory, and anticancer properties, making thiazole-4,5-dicarboxylic acid an essential part of the drug discovery process.
Used in the Development of Novel Materials:
Thiazole-4,5-dicarboxylic acid is also used in the development of new materials with unique properties. Its ability to form stable complexes and its reactivity make it suitable for the creation of materials with potential applications in various industries, such as electronics, coatings, and textiles.
Used as a Catalyst in Chemical Reactions:
Furthermore, thiazole-4,5-dicarboxylic acid has potential applications as a catalyst in chemical reactions. Its ability to facilitate reactions without being consumed in the process can improve the efficiency and selectivity of various chemical processes, contributing to advancements in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 22358-80-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,3,5 and 8 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22358-80:
(7*2)+(6*2)+(5*3)+(4*5)+(3*8)+(2*8)+(1*0)=101
101 % 10 = 1
So 22358-80-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H3NO4S/c7-4(8)2-3(5(9)10)11-1-6-2/h1H,(H,7,8)(H,9,10)
22358-80-1Relevant academic research and scientific papers
Norepinephrine and its metabolites are involved in the synthesis of neuromelanin derived from the locus coeruleus
Wakamatsu, Kazumasa,Tabuchi, Keisuke,Ojika, Makoto,Zucca, Fabio A.,Zecca, Luigi,Ito, Shosuke
, p. 768 - 776 (2015/11/11)
In order to elucidate the chemical structure of black to brown pigments, neuromelanins (NMs), in the substantia nigra (SN) and the locus coeruleus (LC) in the central nervous system of humans and other mammalian species during aging, chemical degradative methods are powerful tools. HPLC analysis after hydroiodic acid hydrolysis detected aminohydroxyphenylethylamines, aminohydroxyphenylacetic acids, and aminohydroxyethylbenzenes, which confirmed that SN-NM and LC-NM contain melanin derived not only from dopamine and norepinephrine (NE) but also from several other catecholic metabolites, such as 3,4-dihydroxyphenylalanine, 3,4-dihydroxyphenylacetic acid, 3,4-dihydroxymandelic acid, 3,4-dihydroxyphenylethanol, and 3,4-dihydroxyphenylethylene glycol, in addition to the corresponding Cys-derivatives in varying degrees. However, hydroiodic acid hydrolysis showed that LC-NM produced the same degradation products as were detected in SN-NM. Thus, we needed to develop a new chemical detection method to validate the existence of NE in LC-NM. In the present study, we report that HCl hydrolysis of LC-NM in the presence of thioglycolic acid yields new products arising from substitution of the hydroxyl group by thioglycolic acid at the benzyl position of NE and cysteinyl-NE. This is the first chemical evidence showing that NE and cysteinyl-NE are incorporated into LC-NM.
