223595-17-3 Usage
Uses
Used in Pharmaceutical Industry:
(1R)-5-Bromo-2,3-dihydro-1-methyl-1H-isoindole is used as a potential pharmaceutical candidate for the development of new drugs. Its unique structure and properties make it a promising starting point for the synthesis of bioactive compounds with therapeutic applications.
Used in Chemical Industry:
In the chemical industry, (1R)-5-Bromo-2,3-dihydro-1-methyl-1H-isoindole can be utilized as an intermediate or building block in the synthesis of other organic compounds. Its specific functional groups and chiral center provide opportunities for further chemical modifications and the creation of novel molecules with desired properties.
Used in Academic Research:
(1R)-5-Bromo-2,3-dihydro-1-methyl-1H-isoindole serves as a valuable research tool in academic settings. Its unique structure and chiral properties make it an interesting subject for studies in organic chemistry, stereochemistry, and the exploration of its potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 223595-17-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,5,9 and 5 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 223595-17:
(8*2)+(7*2)+(6*3)+(5*5)+(4*9)+(3*5)+(2*1)+(1*7)=133
133 % 10 = 3
So 223595-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrN/c1-6-9-3-2-8(10)4-7(9)5-11-6/h2-4,6,11H,5H2,1H3/t6-/m1/s1
