22366-99-0 Usage
Description
1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone is a synthetic chemical compound characterized by an anthraquinone core structure with additional amino group substitutions. It is known for its fluorescent properties, which make it a valuable tool in various applications.
Used in Biomedical Research:
1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone is used as a fluorescent dye for fluorescence microscopy and flow cytometry applications. It allows for the specific labeling and tracking of biological molecules and cells, which is crucial for studying cellular processes and mechanisms.
Used in Medical Diagnostics:
In the medical diagnostics industry, 1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone is used as a fluorescent marker to aid in the detection and analysis of various diseases by visualizing specific cellular components.
Used in Material Science:
1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone is used in the development of new materials due to its fluorescent properties and structural versatility, which can contribute to creating advanced materials with unique characteristics.
Used in Pharmaceutical Development:
1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone also has potential applications in the pharmaceutical industry, where its fluorescent properties and chemical structure can be utilized in the design and synthesis of new drugs, particularly those that require specific targeting or imaging capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 22366-99-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,3,6 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 22366-99:
(7*2)+(6*2)+(5*3)+(4*6)+(3*6)+(2*9)+(1*9)=110
110 % 10 = 0
So 22366-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H19N3O2/c1-20-13-7-8-14(21-10-4-9-19)16-15(13)17(22)11-5-2-3-6-12(11)18(16)23/h2-3,5-8,20-21H,4,9-10,19H2,1H3