223797-01-1 Usage
Uses
1. Used in Pharmaceutical Development:
1-(3-Nitrophenyl)-[1,4]diazepane is used as a potential drug candidate for various therapeutic applications due to its pharmacological properties. It is being investigated for its potential to interact with specific biological targets, which could lead to the development of new medications for various diseases.
2. Used in Research:
In the field of research, 1-(3-Nitrophenyl)-[1,4]diazepane serves as a valuable tool for studying the structure-activity relationships of various biologically active compounds. Its unique chemical structure allows researchers to probe the interactions between molecules and their targets, which can be crucial in understanding the mechanisms of action of potential drugs.
3. Used in Chemical Synthesis:
1-(3-Nitrophenyl)-[1,4]diazepane can also be used as a starting material or intermediate in the synthesis of more complex organic compounds. Its versatile chemical structure makes it a valuable building block for the development of novel molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
4. Used in Drug Design:
1-(3-Nitrophenyl)-[1,4]diazepane is used as a structural template in drug design, particularly for the development of new molecules with improved pharmacological properties. Its diazepane ring and nitrophenyl group can be modified to create a range of derivatives with different biological activities, which can be further optimized for specific therapeutic applications.
5. Used in Medicinal Chemistry:
1-(3-Nitrophenyl)-[1,4]diazepane is employed as a lead compound in medicinal chemistry, where it can be used to identify new targets for drug intervention or to optimize the properties of existing drug candidates. Its unique chemical structure and pharmacological properties make it an attractive starting point for the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 223797-01-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,7,9 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 223797-01:
(8*2)+(7*2)+(6*3)+(5*7)+(4*9)+(3*7)+(2*0)+(1*1)=141
141 % 10 = 1
So 223797-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O2/c15-14(16)11-4-1-3-10(9-11)13-7-2-5-12-6-8-13/h1,3-4,9,12H,2,5-8H2
223797-01-1Relevant academic research and scientific papers
THIENOPYRIDINE DERIVATIVES
-
Page/Page column 119, (2010/11/26)
The present invention provides a compound promoting osteogenesis. The present invention provides a compound having the following general formula (I) wherein R 1 is H or alkyl, R 2 is R a S-, R a O-, R a NH-, R a (R b )N- or cyclic amino, and R a and R b are alkyl which may be substituted, cycloalkyl which may be substituted, or the like, or a pharmacologically acceptable salt thereof.
Heteroaryl diazacycloalkanes, their preparation and use;
-
Page/Page column 20, (2010/11/30)
The present invention discloses compounds of the formula any of its enantiomers or any mixture thereof, isotopes thereof or a pharmaceutically acceptable salt thereof; wherein n is 1, 2 or 3; m is 0, 1 or 2; R represents hydrogen, alkyl, cycloalkyl, cyclo
