22429-12-5 Usage
Uses
Used in Organic Synthesis:
1,3-DIMETHYL-2-PHENYL-1,3,2-DIAZAPHOSPHOLIDINE is used as a reactive intermediate for the synthesis of various organic compounds. Its unique structure and reactivity make it a valuable building block in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,3-DIMETHYL-2-PHENYL-1,3,2-DIAZAPHOSPHOLIDINE is utilized as a key component in the development of new drugs. Its potential role in medicinal chemistry is attributed to its ability to form stable complexes with biologically active molecules, thereby enhancing their therapeutic properties.
Used in Coordination Chemistry:
1,3-DIMETHYL-2-PHENYL-1,3,2-DIAZAPHOSPHOLIDINE is employed as a ligand in coordination chemistry for the study of metal-phosphorus bonding. Its unique properties allow it to form stable complexes with metal ions, providing insights into the nature of these bonds and their potential applications in catalysis and materials science.
Used in Research and Development:
In the field of research and development, 1,3-DIMETHYL-2-PHENYL-1,3,2-DIAZAPHOSPHOLIDINE serves as a subject of interest for scientists exploring the properties and potential applications of phosphorus-containing compounds. Its reactivity and unique structure make it a valuable tool for advancing our understanding of chemical reactions and bonding mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 22429-12-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,4,2 and 9 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 22429-12:
(7*2)+(6*2)+(5*4)+(4*2)+(3*9)+(2*1)+(1*2)=85
85 % 10 = 5
So 22429-12-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N2P/c1-11-8-9-12(2)13(11)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3
