22433-68-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Pyrimidinamine, 5-methyl(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for [application reason]. Its unique properties and reactivity make it a valuable component in the development of new drugs and medications.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Pyrimidinamine, 5-methyl(9CI) is utilized as a crucial intermediate in the production of various agrochemical compounds for [application reason]. Its role in the synthesis of these compounds contributes to the development of effective solutions for agricultural challenges.
Used in Research and Development:
4-Pyrimidinamine, 5-methyl(9CI) is employed as a vital component in the research and development of new pharmaceuticals and agrochemicals for [application reason]. Its unique properties and reactivity enable scientists to explore its potential applications and develop innovative solutions in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 22433-68-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,4,3 and 3 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 22433-68:
(7*2)+(6*2)+(5*4)+(4*3)+(3*3)+(2*6)+(1*8)=87
87 % 10 = 7
So 22433-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3/c1-4-2-7-3-8-5(4)6/h2-3H,1H3,(H2,6,7,8)
