22538-64-3 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
A stereoisomer is a molecule that has the same molecular formula as another molecule but differs in the three-dimensional orientation of its atoms in space.
Explanation
Functional groups are specific groups of atoms within a molecule that have characteristic chemical properties and reactivity.
Explanation
The compound is used as a reagent in organic synthesis, which involves the formation of new chemical bonds and the creation of new compounds.
Explanation
The compound is particularly useful in the preparation of various cyclic compounds, which are molecules with a ring-like structure.
Explanation
As a cross-linking agent, the compound helps to connect or bond polymer chains, improving the strength and stability of the resulting material.
Explanation
The compound may be utilized in the development of pharmaceuticals and agrochemicals, which are chemicals used in the medical and agricultural industries, respectively.
Explanation
Due to its potential hazards, it is important to handle this chemical with care to avoid accidents or adverse effects on health and the environment.
Stereoisomer
1,2-Cyclopropanedicarboxylic anhydride, 3-(chloroformyl)-
Functional groups
Anhydride, chloroformyl
Use as a reagent
Organic synthesis
Application in
Preparation of cyclic compounds
Use as a cross-linking agent
Polymers and resins
Potential use in
Pharmaceutical and agrochemical development
Hazardous nature
Proper handling required
Check Digit Verification of cas no
The CAS Registry Mumber 22538-64-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,5,3 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22538-64:
(7*2)+(6*2)+(5*5)+(4*3)+(3*8)+(2*6)+(1*4)=103
103 % 10 = 3
So 22538-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H3ClO4/c7-4(8)1-2-3(1)6(10)11-5(2)9/h1-3H/t2-,3-/m1/s1
