22553-66-8 Usage
Uses
Used in Chemical Synthesis:
[3aR,4aα,9aβ,(+)]-4α-Acetoxydodecahydro-8β-hydroxy-8aβ-methyl-3,5-bis(methylene)naphtho[2,3-b]furan-2-one is used as a key intermediate in the synthesis of various complex organic molecules. Its unique structure and functional groups make it a valuable building block for creating novel compounds with specific properties and potential applications.
Used in Pharmaceutical Development:
In the pharmaceutical industry, [3aR,4aα,9aβ,(+)]-4α-Acetoxydodecahydro-8β-hydroxy-8aβ-methyl-3,5-bis(methylene)naphtho[2,3-b]furan-2-one can be used as a starting material for the development of new drugs. Its structural features may be exploited to design molecules with specific biological activities, such as targeting particular receptors or enzymes, which could lead to the creation of innovative therapeutic agents.
Used in Material Science:
[3aR,4aα,9aβ,(+)]-4α-Acetoxydodecahydro-8β-hydroxy-8aβ-methyl-3,5-bis(methylene)naphtho[2,3-b]furan-2-one's molecular structure and functional groups may also find applications in material science, where it could be used to develop new materials with unique properties. For example, its acetate and hydroxyl groups could be utilized to create polymers or other materials with specific mechanical, electrical, or optical characteristics.
Used in Analytical Chemistry:
[3aR,4aα,9aβ,(+)]-4α-Acetoxydodecahydro-8β-hydroxy-8aβ-methyl-3,5-bis(methylene)naphtho[2,3-b]furan-2-one can be employed as a reference compound or a standard in analytical chemistry. Its distinct structure and properties may be useful for calibrating instruments, validating analytical methods, or studying chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 22553-66-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,5,5 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22553-66:
(7*2)+(6*2)+(5*5)+(4*5)+(3*3)+(2*6)+(1*6)=98
98 % 10 = 8
So 22553-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H22O5/c1-8-5-6-12(19)17(4)7-11-13(9(2)16(20)22-11)15(14(8)17)21-10(3)18/h11-15,19H,1-2,5-7H2,3-4H3/t11-,12+,13+,14+,15-,17-/m0/s1
22553-66-8Relevant academic research and scientific papers
Unified synthesis of eudesmanolides, combining biomimetic strategies with homogeneous catalysis and free-radical chemistry
Barrero, Alejandro F.,Rosales, Antonio,Cuerva, Juan M.,Oltra, J. Enrique
, p. 1935 - 1938 (2007/10/03)
(Matrix presented) A general procedure for the synthesis of both 12,6- and 12,8-eudesmanolides has been developed. The key step is the titanocene-catalyzed radical cyclization of accessible epoxygermacrolides. The novel reagent 2,4,6-trimethyl-1-trimethylsilylpyridinium chloride, both compatible with oxiranes and capable of regenerating Cp2TiCl 2 from Cp2Ti(Cl)H and Cp2Ti(Cl)OAc, played an important role in the catalytic cycle leading to exocyclic alkenes.
