22568-64-5 Usage
Uses
Used in Pharmaceutical Industry:
(±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide is used as a pharmaceutical compound for its potential therapeutic effects. The compound's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Cardiovascular Applications:
In the cardiovascular field, (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide is used as a metabolite of Acebutolol (A123800), which possesses less β-adrenoceptor blocking potency but greater cardioselectivity (atrial relative to tracheal tissue). This property makes it a valuable compound for the treatment of various cardiovascular conditions, as it can selectively target specific tissues without causing unwanted side effects.
Used in Drug Synthesis:
(±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide can also be used as a key intermediate in the synthesis of other pharmaceutical compounds. Its unique structure and functional groups make it a versatile building block for the development of new drugs with improved efficacy and selectivity.
Used in Research and Development:
Due to its complex structure and potential biological activities, (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide is also used in research and development for the study of various biological processes and the development of novel therapeutic strategies. Researchers can use (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide to investigate its interactions with different biological targets and explore its potential applications in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 22568-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,5,6 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22568-64:
(7*2)+(6*2)+(5*5)+(4*6)+(3*8)+(2*6)+(1*4)=115
115 % 10 = 5
So 22568-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H24N2O4/c1-10(2)17-8-14(21)9-22-16-6-5-13(18-12(4)20)7-15(16)11(3)19/h5-7,10,14,17,21H,8-9H2,1-4H3,(H,18,20)
