2258-24-4 Usage
General Description
3-(2-ethyl-imidazol-1-yl)-propylamine, also known as EIPA, is a chemical compound that belongs to the class of propylamines. It is commonly used as a research chemical in biological and pharmacological studies, particularly in the study of ion channels and transporters. EIPA is known to inhibit the activity of certain ion channels, including NHE (Na+/H+ exchanger), which is involved in maintaining the pH balance inside cells. This inhibition has potential therapeutic implications, particularly in the treatment of conditions such as cancer, hypertension, and heart failure. Additionally, EIPA has been found to have antimicrobial properties and is being investigated for its potential use in controlling the growth of bacteria and fungi. Overall, EIPA is a versatile compound that plays a significant role in various research fields and has potential applications in medicine and antimicrobial treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 2258-24-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,5 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2258-24:
(6*2)+(5*2)+(4*5)+(3*8)+(2*2)+(1*4)=74
74 % 10 = 4
So 2258-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H15N3/c1-2-8-10-5-7-11(8)6-3-4-9/h5,7H,2-4,6,9H2,1H3