2260-00-6 Usage
Uses
Used in Medical and Pharmaceutical Research:
S-Methylisothiourea sulfate is used as a research tool for studying the role of inducible nitric oxide synthase (iNOS) in immune response and inflammation. Its ability to selectively inhibit iNOS makes it a valuable compound in understanding the underlying mechanisms of these processes and potentially developing new therapeutic strategies.
Used in Biological Research:
S-Methylisothiourea sulfate is used as a chemical probe in biological research to investigate the effects of nitric oxide on various cellular processes. By inhibiting iNOS, researchers can gain insights into the role of nitric oxide in cell signaling and other biological functions.
Used in Chemical Research:
S-Methylisothiourea sulfate is used as a reagent in chemical research to explore the synthesis and properties of related compounds. Its unique chemical structure and reactivity make it a useful building block for the development of new chemical entities with potential applications in various fields.
Safety Precautions:
S-Methylisothiourea sulfate is used with caution in laboratory settings due to its potential to cause harm. It is essential to follow proper safety protocols, such as wearing protective clothing, gloves, and eye protection, to minimize the risk of skin irritation or serious eye damage. Additionally, it is crucial to dispose of the compound responsibly and in accordance with local regulations to prevent environmental contamination.
Check Digit Verification of cas no
The CAS Registry Mumber 2260-00-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,6 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2260-00:
(6*2)+(5*2)+(4*6)+(3*0)+(2*0)+(1*0)=46
46 % 10 = 6
So 2260-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C2H6N2S.H2O4S/c1-5-2(3)4;1-5(2,3)4/h1H3,(H3,3,4);(H2,1,2,3,4)/p-1
