22601-63-4 Usage
Description
Bacitracin F, a major analog of Bacitracin (B106500), is a peptide antibiotic that possesses potent antimicrobial properties. It functions as an inhibitor of protein disulfide isomerase (PDI), which plays a crucial role in protein folding and redox regulation. This characteristic makes bacitracin F a valuable compound in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
Bacitracin F is used as an antimicrobial agent for its ability to inhibit bacterial growth, making it a valuable component in the development of antibiotics and other therapeutic treatments targeting bacterial infections.
Used in Research Applications:
In the field of scientific research, bacitracin F is utilized as a specific inhibitor of PDI. This application is crucial for studying the role of PDI in cellular processes, protein folding, and redox regulation, contributing to a deeper understanding of cellular mechanisms and potential therapeutic targets.
Used in Drug Development:
Due to its inhibitory effect on PDI, bacitracin F is also employed in the development of novel drugs targeting various diseases, including cancer and neurodegenerative disorders. By modulating PDI activity, these drugs may potentially influence protein folding and redox balance, offering new treatment options for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 22601-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,6,0 and 1 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 22601-63:
(7*2)+(6*2)+(5*6)+(4*0)+(3*1)+(2*6)+(1*3)=74
74 % 10 = 4
So 22601-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C66H98N16O17S/c1-9-35(6)52(82-58(92)42(22-23-50(84)85)73-59(93)43(26-34(4)5)75-63(97)48-32-100-66(80-48)54(88)37(8)11-3)64(98)74-40-20-15-16-25-70-55(89)46(29-49(68)83)77-62(96)47(30-51(86)87)78-61(95)45(28-39-31-69-33-71-39)76-60(94)44(27-38-18-13-12-14-19-38)79-65(99)53(36(7)10-2)81-57(91)41(21-17-24-67)72-56(40)90/h12-14,18-19,31-37,40-47,52-53H,9-11,15-17,20-30,67H2,1-8H3,(H2,68,83)(H,69,71)(H,70,89)(H,72,90)(H,73,93)(H,74,98)(H,75,97)(H,76,94)(H,77,96)(H,78,95)(H,79,99)(H,81,91)(H,82,92)(H,84,85)(H,86,87)