22604-06-4 Usage
Uses
Used in Pharmaceutical Industry:
[(4-oxo-2-thiazolin-2-yl)thio]acetic acid is used as a drug intermediate for its potential biological activities. [(4-oxo-2-thiazolin-2-yl)thio]acetic acid's unique structure allows it to be a promising candidate for the development of new pharmaceuticals, particularly in the areas of therapeutics and medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical industry, [(4-oxo-2-thiazolin-2-yl)thio]acetic acid is used for its potential applications in the development of new agrochemical products. Its unique structural features may contribute to the creation of novel compounds with improved properties for use in agriculture, such as pesticides, herbicides, and fertilizers.
Used in Organic Synthesis:
[(4-oxo-2-thiazolin-2-yl)thio]acetic acid is used as a key building block in organic synthesis. Its thiazolidine and thioacetic acid moieties make it a valuable component for the synthesis of various organic compounds, which can be further utilized in the development of new materials, pharmaceuticals, and other chemical products.
Used in Material Science:
In the field of material science, [(4-oxo-2-thiazolin-2-yl)thio]acetic acid is used for its potential to contribute to the development of new materials with unique properties. Its structural features may be exploited to create materials with enhanced performance characteristics, such as improved stability, reactivity, or selectivity, for use in various applications, including electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 22604-06-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,6,0 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22604-06:
(7*2)+(6*2)+(5*6)+(4*0)+(3*4)+(2*0)+(1*6)=74
74 % 10 = 4
So 22604-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NO3S2/c7-3-1-10-5(6-3)11-2-4(8)9/h1-2H2,(H,8,9)
