226703-16-8 Usage
Uses
Used in Organic Chemistry Research:
2-Cyclopenten-1-one,2-bromo-3-ethoxy-(9CI) is used as a chemical substrate for various reactions in the field of organic chemistry. Its unique structure with a bromine atom and an ethoxy group allows for exploration in synthesis and reaction mechanisms, which could lead to the development of new compounds and materials.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2-Cyclopenten-1-one,2-bromo-3-ethoxy-(9CI) may be utilized as a starting material or intermediate in the synthesis of new drug candidates. Its potential reactivity and structural features could be harnessed to create novel therapeutic agents, particularly in the area of medicinal chemistry where the exploration of new chemical entities is ongoing.
Used in Material Science:
2-Cyclopenten-1-one,2-bromo-3-ethoxy-(9CI) could also be employed in material science applications, where its properties might be exploited to develop new materials with specific characteristics. 2-Cyclopenten-1-one,2-bromo-3-ethoxy-(9CI)'s potential role in creating advanced materials or contributing to the understanding of material properties could be significant in fields such as nanotechnology, polymer science, or materials engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 226703-16-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,6,7,0 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 226703-16:
(8*2)+(7*2)+(6*6)+(5*7)+(4*0)+(3*3)+(2*1)+(1*6)=118
118 % 10 = 8
So 226703-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9BrO2/c1-2-10-6-4-3-5(9)7(6)8/h2-4H2,1H3
