2269-06-9 Usage
Description
(S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride is a chemical compound belonging to the dibenzoquinolinium family. It is a salt form of a tetramethoxy tetrahydro compound with a chloride ion as a counterion. (S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride has demonstrated potential pharmaceutical and biological activities, including anti-inflammatory, antimicrobial, and antitumor properties. Its unique structural and spectral properties also make it a suitable candidate as a fluorescent probe for DNA detection and labeling.
Uses
Used in Pharmaceutical Research:
(S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride is used as a research compound for its potential pharmaceutical applications due to its anti-inflammatory, antimicrobial, and antitumor properties. It is being investigated for its possible use in the development of new drugs targeting various diseases and conditions.
Used in Analytical Chemistry:
In the field of analytical chemistry, (S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride is used as a fluorescent probe for DNA detection and labeling. Its unique structural and spectral properties allow for the identification and analysis of specific DNA sequences, which can be crucial in various research and diagnostic applications.
Used in Biomedical Research:
(S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride is also utilized in biomedical research to study its potential biological activities and mechanisms of action. Further research is required to fully understand its applications and potential impact on human health and disease.
Check Digit Verification of cas no
The CAS Registry Mumber 2269-06-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,6 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2269-06:
(6*2)+(5*2)+(4*6)+(3*9)+(2*0)+(1*6)=79
79 % 10 = 9
So 2269-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H25NO4.ClH/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20;/h9-11,15H,6-8H2,1-5H3;1H/t15-;/m0./s1