2269-06-9 Usage
General Description
(S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride is a chemical compound that is a derivative of the dibenzoquinolinium family. It is a salt form of a tetramethoxy tetrahydro compound and has a chloride ion as a counterion. (S)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinolinium chloride is used for various research and analytical purposes as it has shown potential pharmaceutical and biological activities. It is known to have anti-inflammatory, antimicrobial, and antitumor properties. Additionally, it is also used as a fluorescent probe for DNA detection and labeling due to its unique structural and spectral properties. However, further research is required to fully understand its potential applications and mechanisms of action.
Check Digit Verification of cas no
The CAS Registry Mumber 2269-06-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,6 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2269-06:
(6*2)+(5*2)+(4*6)+(3*9)+(2*0)+(1*6)=79
79 % 10 = 9
So 2269-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H25NO4.ClH/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20;/h9-11,15H,6-8H2,1-5H3;1H/t15-;/m0./s1