22690-27-3 Usage
Chemical structure
A complex and unique fused-ring system containing a cyclooctene ring and a methano bridge.
Molecular configuration
Rigid and stable due to the presence of the fused-ring system and methano bridge.
Applications
Commonly used in organic synthesis and pharmaceutical research.
Biological activity
Possesses potential biological activity, making it a valuable compound for studying molecular interactions and developing new drug candidates.
Structural versatility
Its compact and rigid molecular structure allows for the creation of new drug candidates and the study of various molecular interactions.
Research interest
An interesting target for chemical and medicinal chemistry research due to its unique structure and properties.
Synthesis
The compound can be synthesized through various chemical reactions and techniques, allowing for further exploration of its properties and potential applications.
Stability
The rigid molecular configuration contributes to the compound's stability, making it suitable for use in various chemical and biological studies.
Reactivity
The presence of the cyclooctene ring and methano bridge may influence the compound's reactivity, allowing for the exploration of its potential as a reactant in various chemical reactions.
Derivatives
The unique structure of 1,2,3,4,5,6,7,8,9,10-decahydro-5,9-methanobenzocycloocten-11-one may enable the synthesis of various derivatives with different properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 22690-27-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,6,9 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 22690-27:
(7*2)+(6*2)+(5*6)+(4*9)+(3*0)+(2*2)+(1*7)=103
103 % 10 = 3
So 22690-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H20O/c1-9-10-5-2-3-6-12(10)13-8-4-7-11(9)14(13)15/h9,11,13H,2-8H2,1H3
22690-27-3Relevant articles and documents
Synthesis and isomerization of tricyclo[7.3.1.02,7]tridecen-13-ones
Rostovskaya,Vysotskaya,Grigorchuk,Vysotskii
, p. 1414 - 1417 (2007/10/03)
Dehydration of 2-hydroxy-8-R-tricyclo[7.3.1.02,7]tridecan-13-ones (R = H, Me, Ph) effected by various reagents provided 8-R-tricyclo[7.3.1.02,7]tridecen-13-ones with different positions of the double bond. In the presence of phosphoric acid arise isomers with the double bond in 2(3) position, a mixture of hydrochloric and acetic acid primarily affords isomers with the double bond in 2(7) position that further migrates into 7(8) position at R = Me, Ph.
