22715-34-0 Usage
Uses
Used in Pharmaceutical Industry:
2(1H)-PyriMidinone, 4,5,6-triaMinois used as a key intermediate in the synthesis of pharmaceutical drugs for its potential role in creating anticancer and antiviral medications. Its unique structure allows for the development of compounds that can target specific biological pathways, making it a promising candidate for advanced drug design.
Used in Chemical Synthesis:
In the chemical industry, 2(1H)-PyriMidinone, 4,5,6-triaMinoserves as a valuable starting material for the synthesis of diverse chemical compounds. Its reactivity and functional groups enable the creation of a broad range of products, contributing to various applications across different sectors.
Used in Agrochemical Industry:
2(1H)-PyriMidinone, 4,5,6-triaMinois also utilized in the agrochemical field as a component in the development of new pesticides or other agricultural chemicals. Its properties allow for the design of compounds that can effectively address pest control and crop protection needs while ensuring environmental safety.
Check Digit Verification of cas no
The CAS Registry Mumber 22715-34-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,7,1 and 5 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22715-34:
(7*2)+(6*2)+(5*7)+(4*1)+(3*5)+(2*3)+(1*4)=90
90 % 10 = 0
So 22715-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N5O/c5-1-2(6)8-4(10)9-3(1)7/h5H2,(H5,6,7,8,9,10)
