227199-09-9 Usage
Uses
Used in Chemical Production Industry:
2-ISOPROPYL-N,N,6-TRIMETHYLANILINE is used as an intermediate for the production of dyes, pigments, and pharmaceuticals due to its ability to participate in various chemical reactions and form a wide range of compounds.
Used in Catalyst Applications:
ITA is used as a catalyst in various chemical reactions, leveraging its unique chemical structure and reactivity to facilitate and enhance the efficiency of these processes.
Used in Corrosion Inhibition:
2-ISOPROPYL-N,N,6-TRIMETHYLANILINE is used in the synthesis of corrosion inhibitors, contributing to the development of products that protect materials from degradation and extend their service life.
Used in Antioxidant Synthesis:
ITA plays a role in the creation of antioxidants, which are essential in various industries to prevent oxidation and spoilage, thereby improving the stability and longevity of products.
Used in Alkylated Amine Production:
2-ISOPROPYL-N,N,6-TRIMETHYLANILINE is utilized in the synthesis of alkylated amines, which have applications in various chemical processes and products, such as surfactants and detergents.
Check Digit Verification of cas no
The CAS Registry Mumber 227199-09-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,7,1,9 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 227199-09:
(8*2)+(7*2)+(6*7)+(5*1)+(4*9)+(3*9)+(2*0)+(1*9)=149
149 % 10 = 9
So 227199-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H19N/c1-9(2)11-8-6-7-10(3)12(11)13(4)5/h6-9H,1-5H3
