22758-10-7 Usage
Uses
Used in Chemical Synthesis:
2-Bromo-5-nitro-1,3,4-thiadiazole is used as a key intermediate in the synthesis of various chemical compounds. Its unique structure and reactivity make it a valuable building block for creating new molecules with potential applications in different industries.
Used in Research Applications:
In the field of scientific research, 2-Bromo-5-nitro-1,3,4-thiadiazole is employed as a reagent or a model compound to study chemical reactions and mechanisms. Its properties allow researchers to gain insights into the behavior of similar compounds and develop new synthetic strategies.
Used in Pharmaceutical Development:
2-Bromo-5-nitro-1,3,4-thiadiazole is used as a starting material in the development of new pharmaceutical compounds. Its chemical structure can be modified to create potential drug candidates with therapeutic properties, contributing to the advancement of medicine.
Used in Material Science:
In material science, 2-Bromo-5-nitro-1,3,4-thiadiazole is used as a component in the synthesis of novel materials with unique properties. Its incorporation into materials can lead to the development of new products with improved performance in various applications, such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 22758-10-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,7,5 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22758-10:
(7*2)+(6*2)+(5*7)+(4*5)+(3*8)+(2*1)+(1*0)=107
107 % 10 = 7
So 22758-10-7 is a valid CAS Registry Number.
InChI:InChI=1/C2BrN3O2S/c3-1-4-5-2(9-1)6(7)8
22758-10-7Relevant academic research and scientific papers
TRISUBSTITUTED BORON-CONTAINING MOLECULES
-
Page/Page column 276, (2011/02/24)
This invention largely relates to 3,4,6-trisubstituted benzoxaborole compounds, and their use for treating bacterial infections.
BORON-CONTAINING SMALL MOLECULES
-
Page/Page column 121, (2012/06/05)
This invention relates to, among other items, 6-substituted benzoxaborole compounds and their use for treating bacterial infections.
