22789-96-4 Usage
Uses
Used in Pharmaceutical Industry:
[1-methyl-2-[(2-methyl-1-oxoallyl)oxy]ethyl] hydrogen maleate is used as a potential drug candidate in the pharmaceutical industry due to its unique chemical structure and properties. [1-methyl-2-[(2-methyl-1-oxoallyl)oxy]ethyl] hydrogen maleate's synthesis and chemical properties make it a promising candidate for further research and development in the field of drug discovery.
Used in Research Applications:
In addition to its potential as a drug candidate, [1-methyl-2-[(2-methyl-1-oxoallyl)oxy]ethyl] hydrogen maleate is also utilized in research applications. Its unique structure and properties make it an important tool for understanding the reactions and properties of similar compounds, contributing to the advancement of scientific knowledge in the field of chemistry and related disciplines.
Used in Chemical Synthesis:
[1-methyl-2-[(2-methyl-1-oxoallyl)oxy]ethyl] hydrogen maleate's synthesis and chemical properties also make it a valuable resource for chemical synthesis. It can be used as a building block or intermediate in the creation of more complex molecules, potentially leading to the development of new materials and products in various industries.
Used in Material Science:
The unique properties of [1-methyl-2-[(2-methyl-1-oxoallyl)oxy]ethyl] hydrogen maleate may also find applications in material science. Its structure and properties could be harnessed to develop new materials with specific characteristics, such as improved strength, flexibility, or chemical resistance, depending on the requirements of various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 22789-96-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,7,8 and 9 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22789-96:
(7*2)+(6*2)+(5*7)+(4*8)+(3*9)+(2*9)+(1*6)=144
144 % 10 = 4
So 22789-96-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14O6/c1-7(2)11(15)16-6-8(3)17-10(14)5-4-9(12)13/h4-5,8H,1,6H2,2-3H3,(H,12,13)/b5-4-
