2283-49-0 Usage
General Description
(2-chloro-6-methyl-phenoxy)carbonylmethyl-diethyl-azanium chloride is a chemical compound that is commonly used as a herbicide. Its molecular formula is C15H23Cl2NO3 and it is known for its selective control of broad-leaved weeds. (2-chloro-6-methyl-phenoxy)carbonylmethyl-diethyl-azanium chloride works by inhibiting an enzyme involved in the synthesis of amino acids, which ultimately leads to the death of the target plants. It is classified as a chlorophenoxy compound and is typically used in agricultural settings to control weeds in crops such as soybeans, peanuts, and cereals. However, its use has been controversial due to its potential environmental and health hazards, leading to regulations and restrictions on its use in various countries.
Check Digit Verification of cas no
The CAS Registry Mumber 2283-49-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,8 and 3 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2283-49:
(6*2)+(5*2)+(4*8)+(3*3)+(2*4)+(1*9)=80
80 % 10 = 0
So 2283-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H18ClNO2.ClH/c1-4-15(5-2)9-12(16)17-13-10(3)7-6-8-11(13)14;/h6-8H,4-5,9H2,1-3H3;1H