22871-55-2 Usage
Uses
Used in the Production of Polyester Resins:
5-Nitroisophthalic acid monoethyl ester is used as a key component in the synthesis of polyester resins. Its chemical properties contribute to the formation of high-quality resins with desirable characteristics such as durability, heat resistance, and chemical resistance.
Used in the Synthesis of Dyes:
In the dye industry, 5-Nitroisophthalic acid monoethyl ester is used as a building block for the production of various dyes. Its chemical structure allows for the creation of dyes with specific color properties and stability, making it a valuable resource for dye manufacturers.
Used in Pharmaceutical Development:
5-Nitroisophthalic acid monoethyl ester is utilized in the development of pharmaceuticals due to its potential as a starting material for the synthesis of various drug compounds. Its unique chemical properties enable the creation of new and innovative medications with potential therapeutic benefits.
Used in the Manufacture of UV-Absorbers:
5-Nitroisophthalic acid monoethyl ester is employed in the production of UV-absorbers, which are essential in protecting materials from the harmful effects of ultraviolet radiation. Its ability to absorb UV light makes it a crucial component in the formulation of sunscreens, plastics, and other materials that require UV protection.
Check Digit Verification of cas no
The CAS Registry Mumber 22871-55-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,8,7 and 1 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22871-55:
(7*2)+(6*2)+(5*8)+(4*7)+(3*1)+(2*5)+(1*5)=112
112 % 10 = 2
So 22871-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO6/c1-2-17-10(14)7-3-6(9(12)13)4-8(5-7)11(15)16/h3-5H,2H2,1H3,(H,12,13)
