22871-56-3 Usage
Uses
Used in Biochemistry:
3-[[(2-hydroxyethyl)amino]carbonyl]-5-nitrobenzoic acid is used as a fluorescent labeling reagent for the determination of trace amounts of amino acid derivatives in biological samples. Its fluorescent properties allow for sensitive and specific detection of these compounds, facilitating research in proteomics and metabolomics.
Used as a pH Indicator:
HDNB is used as a pH indicator due to its ability to change color in response to changes in pH levels. This makes it a valuable tool in various chemical and biological applications where monitoring pH is crucial for process control and optimization.
Used in Cancer Therapy Research:
3-[[(2-hydroxyethyl)amino]carbonyl]-5-nitrobenzoic acid is studied for its potential as a targeted cancer therapeutic. It has been found to selectively bind to and inhibit certain enzymes in cancer cells, thereby exhibiting anticancer properties. This selective action makes HDNB a promising candidate for the development of targeted cancer treatments with reduced side effects.
Used in Antimicrobial Research:
HDNB has been investigated for its antimicrobial properties, with potential applications in the development of new antimicrobial agents. Its ability to target and inhibit specific microbial enzymes could lead to the creation of more effective and targeted treatments for various infections.
Used in Antioxidant Research:
3-[[(2-hydroxyethyl)amino]carbonyl]-5-nitrobenzoic acid is also being studied for its antioxidant properties. Antioxidants play a crucial role in protecting cells from damage caused by reactive oxygen species, and HDNB's potential in this area could lead to the development of novel antioxidants for use in medicine and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 22871-56-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,8,7 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22871-56:
(7*2)+(6*2)+(5*8)+(4*7)+(3*1)+(2*5)+(1*6)=113
113 % 10 = 3
So 22871-56-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O6/c13-2-1-11-9(14)6-3-7(10(15)16)5-8(4-6)12(17)18/h3-5,13H,1-2H2,(H,11,14)(H,15,16)
