228728-13-0 Usage
Description
7-IODO-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID is a complex organic compound belonging to the class of alkaloids, which are naturally occurring chemical compounds often utilized in pharmaceuticals due to their diverse therapeutic properties. As an isoquinoline derivative, this compound features an iodine atom and a carboxylic acid group, suggesting its potential reactivity. However, there is currently limited information available regarding its physical properties, possible applications, or biological activities, and further scientific research is needed to explore these aspects and any relevant safety considerations.
Uses
Due to the limited information available about 7-IODO-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID, specific applications have not been identified in the provided materials. However, given its classification as an alkaloid and an isoquinoline derivative, it is likely that this compound could have potential uses in various industries, such as pharmaceuticals, based on its chemical properties and reactivity. Further research and development would be required to determine its specific applications and the reasons for their use.
Check Digit Verification of cas no
The CAS Registry Mumber 228728-13-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,8,7,2 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 228728-13:
(8*2)+(7*2)+(6*8)+(5*7)+(4*2)+(3*8)+(2*1)+(1*3)=150
150 % 10 = 0
So 228728-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H10INO2/c11-8-2-1-6-4-9(10(13)14)12-5-7(6)3-8/h1-3,9,12H,4-5H2,(H,13,14)
