22874-92-6 Usage
Main Properties
1. Molecular Formula: C7H12O3
2. Chemical Classification: Ester
3. Odor: Sweet, floral
4. Physical State: Clear, colorless liquid
5. Boiling Point: 194°C
6. Stability: Relatively stable under normal conditions
Specific Content
Allyl ethoxyacetate is the allyl ester of ethoxyacetic acid.
Commonly used as a flavoring agent and fragrance ingredient.
Utilized in the production of perfumes, cosmetics, and scented products.
Used as a solvent in various industrial processes.
Acts as a chemical intermediate in the synthesis of other compounds.
Can react with strong acids or bases and is flammable.
Generally considered safe for use in consumer products when following industry guidelines and regulations.
Check Digit Verification of cas no
The CAS Registry Mumber 22874-92-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,8,7 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 22874-92:
(7*2)+(6*2)+(5*8)+(4*7)+(3*4)+(2*9)+(1*2)=126
126 % 10 = 6
So 22874-92-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O3/c1-3-5-10-7(8)6-9-4-2/h3H,1,4-6H2,2H3
