2291-59-0 Usage
General Description
9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is a chemical compound with a bicyclic structure consisting of a nitrogen-containing azabicyclic ring and a benzene ring. It is commonly used in the pharmaceutical industry for the synthesis of various pharmaceutical compounds. It has been found to possess potential antimicrobial, antiviral, and anti-inflammatory properties, making it a valuable component in drug development. The compound is also known for its ability to act as a chiral auxiliary in asymmetric synthesis, making it a versatile and valuable chemical building block with potential applications in medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 2291-59-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,9 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2291-59:
(6*2)+(5*2)+(4*9)+(3*1)+(2*5)+(1*9)=80
80 % 10 = 0
So 2291-59-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO/c17-15-9-13-7-4-8-14(10-15)16(13)11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2