22919-46-6 Usage
Uses
Used in Medicinal Chemistry:
1-Propylcytosine is used as a chemical intermediate for the synthesis of antiviral and anticancer agents. Its unique structure allows for the development of novel therapeutics that can target specific viral or cancerous processes, potentially leading to more effective treatments.
Used in Drug Development:
In the field of drug development, 1-Propylcytosine serves as a key component in the creation of new pharmaceuticals. Its incorporation into drug molecules can enhance their efficacy, selectivity, and safety profiles, making it a valuable asset in the design of innovative medications.
Used in Nucleic Acid-based Therapeutics:
1-Propylcytosine is used as a building block in the development of nucleic acid-based therapeutics. Its potential to modify the properties of nucleic acids, such as DNA and RNA, can lead to the creation of new therapies for a variety of genetic and infectious diseases.
Further research on the biological and pharmacological properties of 1-Propylcytosine is necessary to fully understand its potential applications in the field of medicine and to unlock its full therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 22919-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,9,1 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22919-46:
(7*2)+(6*2)+(5*9)+(4*1)+(3*9)+(2*4)+(1*6)=116
116 % 10 = 6
So 22919-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O/c1-2-4-10-5-3-6(8)9-7(10)11/h3,5H,2,4H2,1H3,(H2,8,9,11)
