22979-96-0 Usage
Uses
Used in Organic Synthesis:
N-(2-CARBOXYPHENYL)-GLYCINE MONOPOTASSIUM SALT is used as a synthetic building block for the creation of various organic compounds. Its unique structure allows it to be a versatile component in the synthesis of complex molecules, particularly in the pharmaceutical, agrochemical, and material science industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, N-(2-CARBOXYPHENYL)-GLYCINE MONOPOTASSIUM SALT is used as an intermediate in the development of new drugs. Its chemical properties make it a valuable component in the synthesis of novel therapeutic agents, potentially contributing to the treatment of various diseases and medical conditions.
Used in Agrochemical Industry:
N-(2-CARBOXYPHENYL)-GLYCINE MONOPOTASSIUM SALT is also utilized in the agrochemical industry for the synthesis of new pesticides, herbicides, and other agricultural chemicals. Its unique structure can be exploited to create compounds with enhanced efficacy and selectivity, leading to more effective and environmentally friendly products.
Used in Material Science:
In the field of material science, N-(2-CARBOXYPHENYL)-GLYCINE MONOPOTASSIUM SALT can be used as a component in the development of new materials with specific properties. Its incorporation into polymers, for example, may lead to materials with improved mechanical, thermal, or electrical properties, depending on the desired application.
Overall, N-(2-CARBOXYPHENYL)-GLYCINE MONOPOTASSIUM SALT is a versatile compound with a wide range of applications across different industries, primarily due to its unique chemical structure and properties. Its use in organic synthesis, pharmaceuticals, agrochemicals, and material science highlights its potential for further research and development to create innovative products and solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 22979-96-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,9,7 and 9 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22979-96:
(7*2)+(6*2)+(5*9)+(4*7)+(3*9)+(2*9)+(1*6)=150
150 % 10 = 0
So 22979-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO4.K/c11-8(12)5-10-7-4-2-1-3-6(7)9(13)14;/h1-4,10H,5H2,(H,11,12)(H,13,14);/q;+1/p-1
