23002-52-0 Usage
Uses
Used in Pharmaceutical Industry:
7-Chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidine is used as a chemical intermediate for the synthesis of drugs with various pharmacological actions. Its ability to form complex chemical compounds makes it a valuable component in the development of new medications.
Used in Antifungal Applications:
In the field of antifungal research, 7-Chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidine is used as a base compound for creating antifungal agents. Its structure contributes to the development of drugs that can effectively combat fungal infections.
Used in Antiviral Applications:
7-Chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidine is employed as a starting material for the synthesis of antiviral drugs. Its chemical properties allow for the creation of compounds that can inhibit viral replication and reduce the spread of viral diseases.
Used in Anticancer Applications:
In cancer research, 7-Chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidine is used as a building block for designing anticancer drugs. Its potential to form complex molecules makes it a promising candidate for the development of novel cancer therapies.
Used in Coordination Chemistry:
7-Chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidine is utilized as a versatile ligand in coordination chemistry. Its chelating abilities enable it to form stable complexes with various metal ions, which can be used in a wide range of applications, including catalysis and the development of new materials.
Check Digit Verification of cas no
The CAS Registry Mumber 23002-52-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,0,0 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 23002-52:
(7*2)+(6*3)+(5*0)+(4*0)+(3*2)+(2*5)+(1*2)=50
50 % 10 = 0
So 23002-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H2ClN5/c5-3-2-4(7-1-6-3)9-10-8-2/h1H,(H,6,7,8,9,10)
